N-Acetylmuramic acid | MedChemExpress (MCE)
N-acetylmuramic acid is a component of the bacterial cell wall peptidoglycan, essential for maintaining cell shape and integrity[1]. N-acetylmuramic acid inhibits spore germination by inhibiting a coat-associated hexosaminidase and a core enzyme[2]. N-acetylmuramic acid is required by Bacteroides forsythus for proliferation and the maintenance of its cell shape[3].
| Trivial name | N-Acetylmuramic acid |
| Catalog Number | HY-W009274 |
| Alternative Name(s) | MurNAc; NAMA |
| Research Area | Others |
| CAS# | 10597-89-4 |
| Purity | ≥98.0% |
| SMILES | CC(N[C@@H](C=O)[C@@H](O[C@H](C)C(O)=O)[C@H](O)[C@H](O)CO)=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/n-acetylmuramic-acid.html |