1-Thio-β-D-glucose sodium | MedChemExpress (MCE)
1-Thio-β-D-glucose sodium is the sodium salt form of 1-Thio-β-D-glucose. 1-Thio-β-D-glucose forms hydrophilic self-assembled monolayer with metal, stablizes the lipid bilayer and protects the proteins from denaturation[1].
| Trivial name | 1-Thio-β-D-glucose sodium |
| Catalog Number | HY-115419 |
| Research Area | Others |
| CAS# | 10593-29-0 |
| Purity | ≥98.0% |
| SMILES | O[C@@H]([C@@H]([C@H]([C@@H](O1)S)O)O)[C@H]1CO[Na] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/1-thio-β-d-glucose-sodium.html |