4-Hydroxy-Teriflunomide
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-T-28773 |
| Alternative Name(s) | (2Z)romethyl)phenyl]-2-butenamide |
| Research Area | 4-Hydroxy-Teriflunomide is a metabolite of Leflunomide , an immunosuppressive. Inhibits T and B cell proliferation. Activity is attributed mainly to its metabolite, a malononitrile derivative, which is beleived to inhibit dihydroorotate dehydrogenase as well as several protein tyrosine kinases. Therapeutically as a antirheumatic (Merck Index). |
| Molecular Formula | C12H9F3N2O3 |
| CAS# | 1058722-45-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(/C(C#N)=C(O)/CO)NC1=CC=C(C(F)(F)F)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST28773.html |
| Additional Information | NULL |