AT13148 10mM * 1mL in DMSO
AT13148 is a novel oral multi-AGC kinase inhibitor with potent pharmacodynamic and antitumor activity, which shows a distinct mechanism of action from other AKT inhibitors.
Trivial name | AT13148 10mM * 1mL in DMSO |
Catalog Number | A12464-10mM-D |
Alternative Name(s) | (S)-1-(4-(1H-pyrazol-4-yl)phenyl)-2-amino-1-(4-chlorophenyl)ethanol |
Molecular Formula | C17H16ClN3O |
CAS# | 1056901-62-2 |
SMILES | C1=CC(=CC=C1C2=CNN=C2)[C@@](CN)(C3=CC=C(C=C3)Cl)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/at13148.html |