Ranolazine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06919 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Ranolazine, intended for use as an internal standard for the quantification of Ranolazine by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H30D3N3O4 |
| CAS# | 1054624-77-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CN1CCN(CC(NC(C(C)=CC=C2)=C2C)=O)CC1)COC(C=CC=C3)=C3OC([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06919.html |
| Additional Information | NULL |