7-Epi Paclitaxel
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-31068 |
| Alternative Name(s) | 7-Epipaclitaxel;(2aR,4R,4aS,6S,9S,11S,12S,12aS,12bS)-9-(((2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoyl)oxy)-12-(benzoyloxy)-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-2a,3,4,4a,5,6,9,10,11,12,12a,12b-d3,4]benzo[1,2-b]oxete-6,12b-diyl diacetate. |
| Research Area | The compund has been isolated from Taxus brevifolia. It is an antineoplastic that is currently being used in cancer research. |
| Molecular Formula | C47H51NO14 |
| CAS# | 105454-04-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O[C@@]1([C@](C[C@H]2O)([H])OC1)[C@@]([C@@]2(C3=O)C)([H])[C@@H]([C@@](C4(C)C)(C[C@H](OC([C@H](O)[C@H](C5=CC=CC=C5)NC(C6=CC=CC=C6)=O)=O)C(C)=C4[C@H]3OC(C)=O)O)OC(C7=CC=CC=C7)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31068.html |
| Additional Information | NULL |