Tyrphostin 9
Selective EGFR/PDGFR inhibitor Tyrosine Kinase|VEGFR
| Catalog Number | B1494-50 |
| Research Area | Tyrosine Kinase|VEGFR |
| Molecular Formula | C18H22N2O |
| CAS# | 10537-47-0 |
| Purity | 99.68% |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C=C(C#N)C#N |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1494 |
