Azumolene sodium | MedChemExpress (MCE)
Azumolene sodium (EU4093) is an analog of Dantrolene (HY-12542) that inhibits malignant hyperthermia (MH) syndrome and intracellular Ca2+ homeostasis failure caused by Halothane (HY-B1010)/Succinylcholine. Azumolene sodium (0.5-2.0 mg/kg) reduces [Ca2+]i (from 207 nM to 38 nM) in MH-susceptible skeletal muscle following intramuscular injection[1].
| Trivial name | Azumolene sodium |
| Catalog Number | HY-113920 |
| Alternative Name(s) | EU4093 |
| Research Area | Others |
| CAS# | 105336-14-9 |
| Purity | ≥98.0% |
| SMILES | O=C1NC(CN1/N=C/C2=NC=C(C3=CC=C(Br)C=C3)O2)=O.[Na] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/azumolene-sodium.html |