SBE 13 HCl 10mM * 1mL in DMSO
SBE 13 HCl is a selective inhibitor of PLK1 (IC50 values are 200 pM, 875 nM and 66 ??M for PLK1, PLK3 and PLK2 respectively).
| Trivial name | SBE 13 HCl 10mM * 1mL in DMSO |
| Catalog Number | A14426-10mM-D |
| Alternative Name(s) | N-[[4-[(6-Chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-3,4-dimethoxybenzeneethanamine hydrochloride |
| Molecular Formula | C24H27ClN2O4.HC |
| CAS# | 1052532-15-6 |
| SMILES | COC1=C(C=C(C=C1)CCNCC2=CC(=C(C=C2)OCC3=CN=C(C=C3)Cl)OC)OC.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sbe-13-hcl.html |