Dolutegravir D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03645 |
| Alternative Name(s) | (4R,12aS)-N-(2,4-difluoro-3,5,6-trimethyl-D3-benzyl)-7-hydroxy-4-methyl-8-oxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide |
| Research Area | Dolutegravir Stable Isotope; Dolutegravir Deuterated, Intended for use as an internal standard for the quantification of Dolutegravir by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H18D3F2N3O4 |
| CAS# | 1051375-16-6 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N([C@@H]1C)[C@](OCC1)([H])CN2C=C(C(NC([2H])([2H])C(C=CC(F)=C3[2H])=C3F)=O)C4=O)C2=C4O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03645.html |
| Additional Information | NULL |