Torbafylline | MedChemExpress (MCE)
Torbafylline is a PDE inhibitor. Torbafylline mitigates protein breakdown in rat skeletal muscle following burns by activating the PDE4/cAMP/EPAC/PI3K/Akt signaling pathway. Torbafylline suppresses the increased ubiquitin-proteasome-dependent protein degradation observed in the skeletal muscles of rats susceptible to cancer and sepsis[1].
| Trivial name | Torbafylline |
| Catalog Number | HY-160864 |
| Alternative Name(s) | HWA 448 |
| Research Area | Cancer |
| CAS# | 105102-21-4 |
| Purity | ≥98.0% |
| SMILES | O=C1C2=C(N(C)C(N1CCCCC(C)(C)O)=O)N=CN2COCC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/torbafylline.html |