AST-6 10mM * 1mL in DMSO
AST-6 is a novel irreversible inhibitor of the epidermal growth factor receptor 1 and 2, inhibits tumor growth both in vitro and in vivo
Trivial name | AST-6 10mM * 1mL in DMSO |
Catalog Number | A10062-10mM-D |
Alternative Name(s) | N-[4-[[3-Chloro-4-[(3-fluorophenyl)methoxy]phenyl]amino]-6-quinazolinyl]-2-propenamide 4-methylbenzenesulfonate |
Molecular Formula | C₂₄H₁₈ClFN₄O₂.C₇H₈O₃S |
CAS# | 1050500-29-2 |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=C(C=C3)OCC4=CC(=CC=C4)F)Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/ast-6.html |