Hydroxy Mifepristone D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02648 |
| Alternative Name(s) | (10S,11S,14R,15S,17R)-17-{4- [bis(²H3)methylamino]phenyl}-14-hydroxy-14-(3- hydroxyprop-1-yn-1-yl)-15- methylte-1,6- dien-5-one ; CS-P-04808 |
| Research Area | Labeled Mifepristone, intended for use as an internal standard for the quantification of Mifepristone by GC- or LC-mass spectrometry. |
| Molecular Formula | C29H29D6NO3 |
| CAS# | 105012-15-5 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C[C@@H]1C2=CC=C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])C=C2)([C@]3(O)C#CCO)[C@](CC3)([H])[C@@](CC4)([H])C1=C(CC5)C4=CC5=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02648.html |
| Additional Information | NULL |