Ascomycin 10mM * 1mL in DMSO
Ascomycin is a potent immunosuppressive agent that could be used as a potential therapeutic agent for autoimmune diseases.
Trivial name | Ascomycin 10mM * 1mL in DMSO |
Catalog Number | A12592-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C43H69NO12 |
CAS# | 104987-12-4 |
SMILES | CC[C@@H]1/C=C(/C[C@@H](C[C@@H]([C@@H]2[C@H](C[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H]([C@@H]([C@H](CC1=O)O)C)/C(=C/[C@@H]4CC[C@H]([C@@H](C4)OC)O)/C)O)C)OC)OC)C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/ascomycin.html |