Tacrolimus
Tacrolimus is a potent immunosuppressive drug often administered to transplant recipient patients and exhibits a variety of adverse cardiovascular effects. Its mechanism of action involves the formation of a high affinity complex (Ki = 0.2 nM) with FK-506 binding protein 12 (FKBP12).
| Trivial name | FR 900506; FK 506; Fujimycin |
| Catalog Number | CSN15684 |
| Alternative Name(s) | FR 900506; FK 506; Fujimycin |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C44H69NO12 |
| CAS# | 104987-11-3 |
| Purity | ≥99% |
| SMILES | O=C([C@@](CCCC1)([H])N1C(C([C@@]2(O)[C@H](C)C[C@H](OC)[C@@](O2)([H])[C@@H](OC)C[C@@H](C)C/C(C)=C/[C@H]3CC=C)=O)=O)O[C@H](/C(C)=C/[C@H]4C[C@@H](OC)[C@H](O)CC4)[C@H](C)[C@@H](O)CC3=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/tacrolimus.html |
