FK-506 50mg
FK-506 is an immunosuppressive drug that is mainly used after allogeneic organ transplant to reduce the activity of the patient’s immune system and so lower the risk of organ rejection. It reduces interleukin-2 (IL-2) production by T-cells.
| Trivial name | FK-506 50mg |
| Catalog Number | A10389-50 |
| Alternative Name(s) | N/A |
| Molecular Formula | C44H69NO12 |
| CAS# | 104987-11-3 |
| SMILES | C[C@@H]1C[C@@H]([C@@H]2[C@H](C[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H]([C@@H]([C@H](CC(=O)[C@@H](/C=C(/C1)C)CC=C)O)C)/C(=C/[C@@H]4CC[C@H]([C@@H](C4)OC)O)/C)O)C)OC)OC |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/fk-506.html |
