FK-506 500mg
FK-506 is an immunosuppressive drug that is mainly used after allogeneic organ transplant to reduce the activity of the patient’s immune system and so lower the risk of organ rejection. It reduces interleukin-2 (IL-2) production by T-cells.
| Trivial name | FK-506 500mg |
| Catalog Number | A10389-500 |
| Alternative Name(s) | N/A |
| Molecular Formula | C44H69NO12 |
| CAS# | 104987-11-3 |
| SMILES | C[C@@H]1C[C@@H]([C@@H]2[C@H](C[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H]([C@@H]([C@H](CC(=O)[C@@H](/C=C(/C1)C)CC=C)O)C)/C(=C/[C@@H]4CC[C@H]([C@@H](C4)OC)O)/C)O)C)OC)OC |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/fk-506.html |
