FK-506 10mM * 1mL in DMSO
FK-506 is an immunosuppressive drug that is mainly used after allogeneic organ transplant to reduce the activity of the patient’s immune system and so lower the risk of organ rejection. It reduces interleukin-2 (IL-2) production by T-cells.
| Trivial name | FK-506 10mM * 1mL in DMSO |
| Catalog Number | A10389-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C44H69NO12 |
| CAS# | 104987-11-3 |
| SMILES | C[C@@H]1C[C@@H]([C@@H]2[C@H](C[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H]([C@@H]([C@H](CC(=O)[C@@H](/C=C(/C1)C)CC=C)O)C)/C(=C/[C@@H]4CC[C@H]([C@@H](C4)OC)O)/C)O)C)OC)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/fk-506.html |
