Latromotide | MedChemExpress (MCE)
Latromotide is a synthetic peptide with antineoplastic activity. It consists of 10 amino acids corresponding to amino acid residues 66-75 of the human kinesin-like protein KIF20A. Latromotide has a sequence of H-Lys-Val-Tyr-Leu-Arg-Val-Arg-Pro Leu-Leu-OH[1].
Trivial name | Latromotide |
Catalog Number | HY-115379 |
Research Area | Cancer |
CAS# | 1049674-65-8 |
Purity | ≥98.00% |
SMILES | OC(C=C1)=CC=C1C[C@H](NC([C@H](C(C)C)NC([C@@H](N)CCCCN)=O)=O)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](C(C)C)C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N[C@@H](CC(C)C)C(N[C@H](C(O)=O)CC(C)C)=O)=O)=O)=O)=O)=O)=O |
PubChem Chemical Structure ID | 57340955 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/latromotide.html |