UPF 1069 10mM * 1mL in DMSO
UPF 1069 is a selective poly(ADP-ribose) polymerase (PARP) 2 inhibitor (IC50 values are 0.3 and 8.0 ??M for PARP-2 and PARP-1 respectively).
| Trivial name | UPF 1069 10mM * 1mL in DMSO |
| Catalog Number | A12750-10mM-D |
| Alternative Name(s) | 5-(2-Oxo-2-phenylethoxy)-3,4-dihydr?oisoquinolin-1(2H)-one |
| Molecular Formula | C17H13NO3 |
| CAS# | 1048371-03-4 |
| SMILES | C1=CC=C(C=C1)C(=O)COC2=CC=CC3=C2C=CNC3=O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/upf-1069.html |
