(-)-α-Terpineol
(-)-α-Terpineol has antitumour, anti-inflammatory, and antimicrobial activities, it inhibits the growth of tumour cells through a mechanism that involves inhibition of the NF-kappaB pathway

Catalog Number | T7468 |
Alternative Name(s) | α-Terpineol |
Research Area | Others |
Molecular Formula | C10H18O |
CAS# | 10482-56-1 |
Purity | 98.00% |
SMILES | CC1=CC[C@@H](C(C)(C)O)CC1 |
Size | 1 mL |
Supplier Page | https://www.targetmol.com/compound/(-)-α-Terpineol |
Additional Information | https://www.targetmol.com/datasheet/T7468 |