3′-O-N3-dATP | MedChemExpress (MCE)
3′-O-N3-dATP (3′-O-Azidomethyl dATP) is a modified nucleotide, which is utilized for DNA polymerase. 3′-O-N3-dATP acts as reversible terminator with enhanced raman scattering (SERS) at 2125 cm-1, which determines the DNA sequences continuously[1].
| Trivial name | 3′-O-N3-dATP |
| Catalog Number | HY-160728 |
| Alternative Name(s) | 3′-O-Azidomethyl dATP |
| Research Area | Others |
| CAS# | 1048021-78-8 |
| Purity | ≥98.0% |
| SMILES | NC1=NC=NC2=C1N=CN2[C@@H]3O[C@H](COP(OP(OP(O)(O)=O)(O)=O)(O)=O)[C@@H](OCN=[N+]=[N-])C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/3-o-n3-datp.html |