Caffeic Acid Phenethyl Ester 10mM * 1mL in DMSO
Caffeic acid phenethyl ester is a potent and specific inhibitor of NF-??B activation
| Trivial name | Caffeic Acid Phenethyl Ester 10mM * 1mL in DMSO |
| Catalog Number | A13698-10mM-D |
| Alternative Name(s) | 2-Propenoic acid,3-(3,4-dihydroxyphenyl)-, 2-phenylethyl ester |
| Molecular Formula | C17H16O4 |
| CAS# | 104594-70-9 |
| SMILES | C1=CC=C(C=C1)CCOC(=O)/C=C/C2=CC(=C(C=C2)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/caffeic-acid-phenethyl-ester.html |
