Kazinol F | MedChemExpress (MCE)
Kazinol F is a polyphenol from Broussonetia papyrifera. Kazinol F also is an effective Mpro inhibitor. Kazinol F has interaction with both the catalytic residues (His41 and Cys145) of Mpro and exhibits good binding affinity. Kazinol F can be used for the research of COVID-19[1].
| Trivial name | Kazinol F |
| Catalog Number | HY-113732 |
| Research Area | Inflammation/Immunology; Infection |
| CAS# | 104494-35-1 |
| Purity | ≥98.00% |
| SMILES | OC1=CC(CCCC2=CC=C(C=C2O)O)=C(C(C/C=C(C)\C)=C1O)C/C=C(C)\C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kazinol-f.html |