Bisoprolol fumarate 10mM * 1mL in DMSO
Bisoprolol is a drug belonging to the group of beta blockers, a class of drugs used primarily in cardiovascular diseases. More specifically, it is a selective type ??1 adrenergic receptor blocker.
| Trivial name | Bisoprolol fumarate 10mM * 1mL in DMSO |
| Catalog Number | A10149-10mM-D |
| Alternative Name(s) | 1-[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)amino]-2-propanol fumarate salt |
| Molecular Formula | C22H35NO8 |
| CAS# | 104344-23-2 |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)COCCOC(C)C)O.C(=C/C(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bisoprolol-fumarate.html |