Zolantidine dimaleate | MedChemExpress (MCE)
Zolantidine dimaleate (SKF 95282 dimaleate) is a potent, selective and cross the blood-brain barrier histamine H2 antagonist. Zolantidine dimaleate induces antinociception[1][2].
| Trivial name | Zolantidine dimaleate |
| Catalog Number | HY-101373A |
| Alternative Name(s) | SKF 95282 dimaleate |
| Research Area | Neurological Disease |
| CAS# | 104076-39-3 |
| Purity | 99.88% |
| SMILES | O=C(O)/C=C\C(O)=O.O=C(O)/C=C\C(O)=O.C1(NCCCOC2=CC=CC(CN3CCCCC3)=C2)=NC4=CC=CC=C4S1 |
| PubChem Chemical Structure ID | 11957725 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zolantidine-dimaleate.html |