N-Desmethyl Mifepristone D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02620 |
| Alternative Name(s) | (10S,11S,14S,15S,17R)-14-hydroxy-15-methyl-17-{4-[(²H3)methylamino]phenyl}-14-(prop-1-yn-1-yl)te-1,6-dien-5-one;(11β,17β)-17-Hydroxy-11-[4-(methyl-d3-amino)phenyl]-17-(1-propyn-1-yl)-estra-4,9-dien-3-one; N-Desmethyl-RU 486-d3; RU 42633-d3;CS-P-05477 |
| Research Area | Labeled Mifepristone, intended for use as an internal standard for the quantification of Mifepristone by GC- or LC-mass spectrometry. |
| Molecular Formula | C28H30NO2D3 |
| CAS# | 104004-96-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C[C@@H]1C2=CC=C(NC([2H])([2H])[2H])C=C2)([C@]3(O)C#CC)[C@](CC3)([H])[C@@](CC4)([H])C1=C(CC5)C4=CC5=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02620.html |
| Additional Information | NULL |