JTV-519 | MedChemExpress (MCE)
JTV-519 (K201) is a Ca2+-dependent blocker of sarcoplasmic reticulum Ca2+-stimulated ATPase (SERCA) and a partial agonist of ryanodine receptors in striated muscle. Antiarrhythmic and cardioprotective properties[1][2].
| Trivial name | JTV-519 |
| Catalog Number | HY-15293 |
| Alternative Name(s) | K201 |
| Research Area | Cardiovascular Disease |
| CAS# | 1038410-88-6 |
| Purity | ≥98.00% |
| SMILES | COC1=CC=C2C(CN(C(CCN3CCC(CC4=CC=CC=C4)CC3)=O)CCS2)=C1.Cl |
| PubChem Chemical Structure ID | 9868902 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jtv-519.html |