MBX-2982 25mg
MBX-2982 is a potential first-in-class treatment for type 2 diabetes that targets G protein-coupled receptor 119 (GPR119), a receptor that interacts with bioactive lipids known to stimulate glucose-dependent insulin secretion.
Trivial name | MBX-2982 25mg |
Catalog Number | A12634-25 |
Alternative Name(s) | 4-((4-(1H-tetrazol-1-yl)phenoxy)methyl)-2-(1-(5-ethylpyrimidin-2-yl)piperidin-4-yl)thiazole |
Molecular Formula | C22H24N8OS |
CAS# | 1037792-44-1 |
SMILES | CCC1=CN=C(N=C1)N2CCC(CC2)C3=NC(=CS3)COC4=CC=C(C=C4)N5C=NN=N5 |
Size | 25mg |
Supplier Page | http://www.adooq.com/mbx-2982.html |