R428 10mg
R428 is a selective small molecule inhibitor of Axl kinase, which showed activity to blocks tumor spread and prolongs survival in models of metastatic breast cancer.
| Trivial name | R428 10mg |
| Catalog Number | A13741-10 |
| Alternative Name(s) | 1-(6,7-Dihydro-5H-benzo[6,7]cyclohepta[1,2-c]pyridazin-3-yl)-N3-[(7S)-6,7,8,9-tetrahydro-7-(1-pyrrolidinyl)-5H-benzocyclohepten-2-yl]-1H-1,2,4-triazole-3,5-diamine |
| Molecular Formula | C30H34N8 |
| CAS# | 1037624-75-1 |
| SMILES | C1CCN(C1)[C@H]2CCC3=C(CC2)C=C(C=C3)NC4=NN(C(=N4)N)C5=NN=C6C(=C5)CCCC7=CC=CC=C76 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/r428.html |