AZD4547 10mM * 1mL in DMSO
AZD4547 is a potent, selective and orally active pan-FGFR inhibitor, with IC50s of 0.2, 2.5, 1.8 and 165 nM for FGFR1, 2, 3 and 4, respectively.
Trivial name | AZD4547 10mM * 1mL in DMSO |
Catalog Number | A11075-10mM-D |
Alternative Name(s) | N-(5-(3,5-dimethoxyphenethyl)-1H-pyrazol-3-yl)-4-((3S,5R)-3,5-dimethylpiperazin-1-yl)benzamide |
Molecular Formula | C26H33N5O3 |
CAS# | 1035270-39-3 |
SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=CC=C(C=C2)C(=O)NC3=NNC(=C3)CCC4=CC(=CC(=C4)OC)OC |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/azd4547.html |