Leupeptin Hemisulfate
Leupeptin Hemisulfate is a reversible inhibitor of serine and cysteine proteases. It inhibits cathepsin B (Ki = 6 nM), calpain (Ki = 10 nM), trypsin (Ki = 35 nM), plasmin (Ki = 3.4 μM), and kallikrein (Ki = 19 μM), and has no effect against chymotrypsin, elastase, renin, or pepsin.
Trivial name | N/A |
Catalog Number | S7380 |
Molecular Formula | C20H38N6O4.1/2H2SO4 |
CAS# | 103476-89-7 |
SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C=O)NC(=O)C.CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C=O)NC(=O)C.OS(=O)(=O)O |
Size | 1g |
Supplier Page | http://www.selleckchem.com/products/leupeptin-hemisulfate.html |
Additional Information | https://file.selleck.cn/downloads/struct/Leupeptin-hemisulfate-chemical-structure-s7380.gif |