D-Luciferin sodium salt
D-Luciferin (D-(-)-Luciferin, Firefly luciferin) sodium salt is the natural substrate of luciferases that catalyze the production of light in bioluminescent insects.
| Trivial name | D-(-)-Luciferin sodium salt, Firefly luciferin sodium salt |
| Catalog Number | S6924 |
| Molecular Formula | C11H7N2NaO3S2 |
| CAS# | 103404-75-7 |
| SMILES | OC1=CC=C2N=C(SC2=C1)C3=NC(CS3)C(=O)O[Na] |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/d-luciferin-sodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6924-d-luciferin-sodium-salt-chemical-structure.gif |