Salidroside (Rhodioloside) 10mM * 1mL in DMSO
Salidroside (Rhodioloside) is a glucoside of tyrosol found in the plant Rhodiola rosea. It is thought to be one of the compounds responsible for the antidepressant and anxiolytic actions of this plant, along with rosavin.
| Trivial name | Salidroside (Rhodioloside) 10mM * 1mL in DMSO |
| Catalog Number | A10821-10mM-D |
| Alternative Name(s) | 2-(4-hydroxyphenyl)ethyl ??-D-glucopyranoside |
| Molecular Formula | C14H20O7 |
| CAS# | 10338-51-9 |
| SMILES | C1=CC(=CC=C1CCO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/salidroside-rhodioloside.html |