Monatepil maleate | MedChemExpress (MCE)
Monatepil maleate (AJ-2615) is a potent and orally active Ca2+-channel antagonist and a noncompetitive ACAT inhibitor. Monatepil maleate decreases blood pressure and improves plasma lipid metabolism. Monatepil maleate has the potential for the research of hyperlipidemia[1][2].
| Trivial name | Monatepil maleate |
| Catalog Number | HY-106818A |
| Alternative Name(s) | AJ-2615 |
| Research Area | Metabolic Disease; Cardiovascular Disease |
| CAS# | 103379-03-9 |
| Purity | ≥98.0% |
| SMILES | OC(/C=C\C(O)=O)=O.FC(C=C1)=CC=C1N(CC2)CCN2CCCC(NC3C4=CC=CC=C4CSC5=CC=CC=C53)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/monatepil-maleate.html |
