GNF 5837 10mM * 1mL in DMSO
GNF-5837 is a potent, selective, and orally bioavailable pan-TRK inhibitor that inhibited tumor growth in a mouse xenograft model derived from RIE cells expressing both TRKA and NGF.
| Trivial name | GNF 5837 10mM * 1mL in DMSO |
| Catalog Number | A13730-10mM-D |
| Alternative Name(s) | (Z)-1-(3-((3-((1H-pyrrol-2-yl)methylene)-2-oxoindolin-6-yl)amino)-4-methylphenyl)-3-(2-fluoro-5-(trifluoromethyl)phenyl)urea |
| Molecular Formula | C28H21F4N5O2 |
| CAS# | 1033769-28-6 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)NC2=C(C=CC(=C2)C(F)(F)F)F)NC3=CC4=C(C=C3)/C(=C/C5=CC=CN5)/C(=O)N4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gnf-5837.html |
