GDC-0980 (RG7422)
Class I PI3K inhibitor for PI3Kα/β/δ/γ PI3K/Akt/mTOR Signaling|mTOR
| Catalog Number | B2184-100 |
| Research Area | PI3K/Akt/mTOR Signaling|mTOR |
| Molecular Formula | C23H30N8O3S |
| CAS# | 1032754-93-0 |
| Purity | 98% |
| SMILES | CC1=C(SC2=C1N=C(N=C2N3CCOCC3)C4=CN=C(N=C4)N)CN5CCN(CC5)C(=O)C(C)O |
| Size | 100mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B2184 |
