MK-2206 2HCl 10mM * 1mL in DMSO
MK-2206 2HCl is a highly selective inhibitor of Akt1/2/3 with IC50 of 8 nM/12 nM/65 nM, respectively.
Trivial name | MK-2206 2HCl 10mM * 1mL in DMSO |
Catalog Number | A10003-10mM-D |
Alternative Name(s) | 8-[4-(1-Aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one dihydrochloride |
Molecular Formula | C25H21N5O.2HCl |
CAS# | 1032350-13-2 |
SMILES | C1CC(C1)(C2=CC=C(C=C2)C3=C(C=C4C(=N3)C=CN5C4=NNC5=O)C6=CC=CC=C6)N.Cl.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/mk-2206-dihydrochloride.html |