Endosulfan Sulfate
Marine
| Trivial name | NULL |
| Catalog Number | CS-T-54044 |
| Alternative Name(s) | (5aR,6R,9R,9aS)-6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methanobenzo[e][1,3,2]dioxathiepine 3,3-dioxide; Benzoepin Sulfate; Endosulfan III; Endosulfan Cyclic Sulfate; Endosulfan Sulfate; Endosulfate; Thiodan Sulfate; |
| Research Area | Endosulfan Sulfate is a pesticide used in the control and protection of plant and vegetation. |
| Molecular Formula | C9H6Cl6O4S |
| CAS# | 1031-07-08 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1(C(Cl)=C2Cl)C(CO[S]3(=O)=O)C(CO3)C2(Cl)C1(Cl)Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54044.html |
| Additional Information | NULL |