Losartan-d2 | MedChemExpress (MCE)
Losartan-d2 is the deuterium labeled Losartan[1]. Losartan is an angiotensin II receptor antagonist, competing with the binding of angiotensin II to AT1 receptors with IC50 of 20 nM.
| Trivial name | Losartan-d2 |
| Catalog Number | HY-17512S3 |
| Alternative Name(s) | DuP-753-d2 |
| Research Area | Others |
| CAS# | 1030936-22-1 |
| Purity | ≥98.00% |
| SMILES | CCCCC1=NC(Cl)=C(C([2H])([2H])O)N1CC2=CC=C(C3=C(C4=NN=NN4)C=CC=C3)C=C2 |
| PubChem Chemical Structure ID | 24808540 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/losartan-d2.html |