Losartan D2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02734 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Losartan, intended for use as an internal standard for the quantification of Losartan by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H21D2ClN6O |
| CAS# | 1030936-22-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([2H])([2H])C1=C(Cl)N=C(CCCC)N1CC2=CC=C(C3=C(C4=NN=NN4)C=CC=C3)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02734.html |
| Additional Information | NULL |