MK-8245 10mM * 1mL in DMSO
MK-8245 is a Liver-Targeted Stearoyl-CoA Desaturase (SCD) Inhibitor. MK-8245 is useful for the Treatment of Diabetes and Dyslipidemia.
| Trivial name | MK-8245 10mM * 1mL in DMSO |
| Catalog Number | A11403-10mM-D |
| Alternative Name(s) | 4-(2-Bromo-5-fluorophenoxy)-1-[5-(2H-tetrazol-5-yl)-3-isoxazolyl]piperidine |
| Molecular Formula | C17H16BrFN6O4 |
| CAS# | 1030612-90-8, 1030612-87-3 |
| SMILES | C1CN(CCC1OC2=C(C=CC(=C2)F)Br)C3=NOC(=C3)C4=NN(N=N4)CC(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mk-8245.html |
