3′-O-Methyladenosine | MedChemExpress (MCE)
(2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-(hydroxymethyl)-4-methoxytetrahydrofuran-3-ol (Adenosine, 3′-O-methyl- (8CI)(9CI)) is an adenosine analogue. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. The popular products in this series are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1].
| Trivial name | 3′-O-Methyladenosine |
| Catalog Number | HY-W393243 |
| Research Area | Others |
| CAS# | 10300-22-8 |
| Purity | ≥98.0% |
| SMILES | O[C@@H]1[C@H](OC)[C@@H](CO)O[C@H]1N2C=NC3=C(N=CN=C32)N |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/3-o-methyladenosine.html |