4-Methoxy Rabeprazole
This Impurity will be formed due to the presence of startingmaterials namely 2- Chloromethyl-3-methyl-4 methoxy pyridine hydrochloride and 2-[[[4methoxy-3-methyl-2-pyridinyl] methyl]thio]-1H-benzimidazole is formed which undergoes oxidation to give this Impurity;Impurity in commercial preparations of Rabeprazole
| Catalog Number | CS-O-08047 |
| Alternative Name(s) | Rabeprazole Impurity D;4-Methoxy Rabeprazole;2-[(4-methoxy-3-methylpyridin-2- yl)methanesulfinyl]-1H-1,3-benzodiazole; Rabeprazole Impurity D. |
| Molecular Formula | C15H15N3O2S |
| CAS# | 102804-77-3 |
| Purity | >98% |
| SMILES | O=[S](C1=NC(C=CC=C2)=C2N1)CC(N=CC=C3OC)=C3C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08047.html |