VX-222 10mM * 1mL in DMSO
VX-222 is a small molecule non-nucleoside inhibitor of HCV NS5B polymerase that is being investigated for the treatment of hepatitis C virus infection.
| Trivial name | VX-222 10mM * 1mL in DMSO |
| Catalog Number | A10980-10mM-D |
| Alternative Name(s) | 5-(3,3-Dimethyl-1-butyn-1-yl)-3-[(cis-4-hydroxycyclohexyl)[(trans-4-methylcyclohexyl)carbonyl]amino]-2-thiophenecarboxylic acid |
| Molecular Formula | C25H35NO4S |
| CAS# | 1026785-59-0 |
| SMILES | CC1CCC(CC1)C(=O)N(C2CCC(CC2)O)C3=C(SC(=C3)C#CC(C)(C)C)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/vx-222.html |
