Fadrozole 50mg
Fadrozole is a nonsteroidal aromatase inhibitor exhibiting a very potent and selective inhibitory effect of the aromatase enzyme system in vivo and estrogen biosynthesis in vivo.
| Trivial name | Fadrozole 50mg |
| Catalog Number | A11088-50 |
| Alternative Name(s) | 4-(5,6,7,8-Tetrahydroimidazo[1,5-a]pyridin-5-yl)benzonitrile |
| Molecular Formula | C14H13N3 |
| CAS# | 102676-47-1 |
| SMILES | C1CC(N2C=NC=C2C1)C3=CC=C(C=C3)C#N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/fadrozole.html |