Cholesterol hemisuccinate Tris salt | MedChemExpress (MCE)
Cholesterol hemisuccinate Tris salt (CHS-Tris) is often used to replace cholesterol in protein crystallography, biochemical studies of proteins, and pharmacology. CHS-Tris and Lauryl Maltose Neopentyl Glycol (LMNG) or n-Dodecyl-β-D-Maltoside (DDM) are used together for the solubilization of membrane proteins while maintaining structural integrity and activity. Cholesteryl succinate also reportedly exhibits antiproliferative activity.
| Trivial name | Cholesterol hemisuccinate Tris salt |
| Catalog Number | HY-W010800A |
| Alternative Name(s) | Cholesterol hydrogen succinate Tris salt; CHS-Tris |
| Research Area | Cancer |
| CAS# | 102601-49-0 |
| Purity | ≥98.0% |
| SMILES | OCC(CO)(N)CO.C[C@@]12[C@]3([H])[C@](CC=C1C[C@H](CC2)OC(CCC(O)=O)=O)([H])[C@@]4([H])[C@](CC3)([C@@](CC4)([H])[C@H](C)CCCC(C)C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cholesterol-hemisuccinate-tris-salt.html |