(-)-Huperzine A (HupA)
(-)-Huperzine A is a potent, highly specific and reversible inhibitor of acetylcholinesterase (AChE) with Ki of 7 nM, exhibiting 200-fold more selectivity for G4 AChE over G1 AChE. Also acts as an NMDA receptor antagonist. Phase 4.
| Trivial name | N/A |
| Catalog Number | S2251 |
| Molecular Formula | C22H26N2O4 |
| CAS# | 102518-79-6 |
| SMILES | CC(C)C(C(=O)NC(CC1=CC=CC=C1)C=O)NC(=O)OCC2=CC=CC=C2 |
| Size | 2mg |
| Supplier Page | http://www.selleckchem.com/products/(-)-Huperzine-A.html |
| Additional Information | https://file.selleck.cn/downloads/struct/(-)-Huperzine-A-chemical-structure-S2251.gif |