(-)-Huperzine A 5mg
(-)-Huperzine A is a naturally occurring sesquiterpene alkaloid compound found in the firmoss Huperzia serrata.
| Trivial name | (-)-Huperzine A 5mg |
| Catalog Number | A10006-5 |
| Alternative Name(s) | (1R,9S,13E)- 1-Amino- 13-ethylidene- 11-methyl- 6-azatricyclo[7.3.1.02,7] trideca- 2(7),3,10- trien- 5-one |
| Molecular Formula | C15H18N2O |
| CAS# | 102518-79-6 |
| SMILES | C/C=C1/[C@@H]2CC3=C([C@]1(CC(=C2)C)N)C=CC(=O)N3 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/huperzine-a.html |
