Lupanine hydrochloride | MedChemExpress (MCE)
Lupanine (D-Lupanine) hydrochloride is a natural ketonic derivative of Sparteine ((+)-Sparteine (HY-W008350)) with a ganglioplegic activity. Lupanine hydrochloride shows binding affinity for nicotinic receptor (nAChR) with a Ki value of 500 nM[1].
| Trivial name | Lupanine hydrochloride |
| Catalog Number | HY-N3359B |
| Alternative Name(s) | D-Lupanine hydrochloride |
| Research Area | Neurological Disease |
| CAS# | 1025-39-4 |
| Purity | ≥98.00% |
| SMILES | O=C1N2[C@]([C@](C3)([H])CN(CCCC4)[C@]4([H])[C@]3([H])C2)([H])CCC1.Cl |
| PubChem Chemical Structure ID | 121314 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lupanine-hydrochloride.html |